CAS 1699145-63-5 is the registry number for 2-Amino-3,5-dibromo-6-methoxy-benzonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
2-amino-3,5-dibromo-6-methoxybenzonitrile (CAS 1699145-63-5) is a chemical compound with the molecular formula C8H6Br2N2O and a molecular weight of 305.95 g/mol. IUPAC name: 2-amino-3,5-dibromo-6-methoxybenzonitrile. InChIKey: POIMHRRBPVGMFF-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2N2O |
|---|---|
| Molecular weight | 305.95 g/mol |
| IUPAC name | 2-amino-3,5-dibromo-6-methoxybenzonitrile |
| InChIKey | POIMHRRBPVGMFF-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1C#N)N)Br)Br |
Computed by PubChem (NCBI)