CAS 2055841-29-5 appears in our catalog under these names: 2,3-Dibromo-6-methoxy-1h-pyrrolo[2,3-b]pyridine, 95%, 2,3-Dibromo-6-methoxy-1H-pyrrolo(2,3-b)pyridine, 97%, 2,3-dibromo-6-methoxy-1H-pyrrolo[2,3-b]pyridine, 97%, 97%, 2,3-dibromo-6-methoxy-1H-pyrrolo[2,3-b]pyridine, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 10g, 100mg, 500mg.
2,3-dibromo-6-methoxy-1H-pyrrolo[2,3-b]pyridine (CAS 2055841-29-5) is a chemical compound with the molecular formula C8H6Br2N2O and a molecular weight of 305.95 g/mol. IUPAC name: 2,3-dibromo-6-methoxy-1H-pyrrolo[2,3-b]pyridine. InChIKey: SSJXDKJSRSEXJT-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2N2O |
|---|---|
| Molecular weight | 305.95 g/mol |
| IUPAC name | 2,3-dibromo-6-methoxy-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | SSJXDKJSRSEXJT-UHFFFAOYSA-N |
| SMILES | COC1=NC2=C(C=C1)C(=C(N2)Br)Br |
Computed by PubChem (NCBI)