CAS 1000341-07-0 appears in our catalog under these names: 3,6-Dibromo-5-methoxy-1H-pyrrolo[3,2-b]pyridine, 97%, 3,6-Dibromo-5-methoxy-4-azaindole. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
3,6-dibromo-5-methoxy-1H-pyrrolo[3,2-b]pyridine (CAS 1000341-07-0) is a chemical compound with the molecular formula C8H6Br2N2O and a molecular weight of 305.95 g/mol. IUPAC name: 3,6-dibromo-5-methoxy-1H-pyrrolo[3,2-b]pyridine. InChIKey: JVRJZBZYVVSVLR-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2N2O |
|---|---|
| Molecular weight | 305.95 g/mol |
| IUPAC name | 3,6-dibromo-5-methoxy-1H-pyrrolo[3,2-b]pyridine |
| InChIKey | JVRJZBZYVVSVLR-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=N1)C(=CN2)Br)Br |
Computed by PubChem (NCBI)