CAS 1094566-60-5 is the registry number for 2-(4-Amino-2,6-dibromophenoxy)acetonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-(4-amino-2,6-dibromophenoxy)acetonitrile (CAS 1094566-60-5) is a chemical compound with the molecular formula C8H6Br2N2O and a molecular weight of 305.95 g/mol. IUPAC name: 2-(4-amino-2,6-dibromophenoxy)acetonitrile. InChIKey: PTEBPFGSEUOCCE-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2N2O |
|---|---|
| Molecular weight | 305.95 g/mol |
| IUPAC name | 2-(4-amino-2,6-dibromophenoxy)acetonitrile |
| InChIKey | PTEBPFGSEUOCCE-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)OCC#N)Br)N |
Computed by PubChem (NCBI)