2,4,6-Tri-p-tolyl-1,3,5-triazine, 98%
cas: 6726-45-0 — see every product listed under this CAS number, including other names
2,4,6-Tri-p-tolyl-1,3,5-triazine, 98% (CAS 6726-45-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1186630-250mg |
| cas | 6726-45-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 464.94 Pln | |
| Ambeed | 1g | 1115.75 Pln | |
| BLDpharm | 100mg | 319.91 Pln | |
| BLDpharm | 250mg | 497.63 Pln | |
| BLDpharm | 1g | 1197.38 Pln | |
| Chemat | 100mg | 208.40 Pln | |
| Chemat | 250mg | 338.00 Pln | |
| Chemat | 1g | 731.60 Pln | |
| Fluorochem | 100mg | 294.71 Pln | |
| Fluorochem | 250mg | 456.11 Pln | |
| Fluorochem | 1g | 1138.16 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
2,4,6-tris(4-methylphenyl)-1,3,5-triazine (CAS 6726-45-0) is a chemical compound with the molecular formula C24H21N3 and a molecular weight of 351.4 g/mol. IUPAC name: 2,4,6-tris(4-methylphenyl)-1,3,5-triazine. InChIKey: FLJCTCVDRKPLHJ-UHFFFAOYSA-N.
| Molecular formula | C24H21N3 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | 2,4,6-tris(4-methylphenyl)-1,3,5-triazine |
| InChIKey | FLJCTCVDRKPLHJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NC(=NC(=N2)C3=CC=C(C=C3)C)C4=CC=C(C=C4)C |
Computed by PubChem (NCBI)
Synonyms:
2,4,6-Tris(4-methylphenyl)-1,3,5-triazine, 2,4,6-Tri-p-tolyl-1,3,5-triazine, 2,4,6-trip-tolyl-1,3,5-triazine, Tris(p-tolyl)-1,3,5-triazine, 2,4,6-tris(p-tolyl)-1,3,5-triazine, 1,3,5-Triazine, 2,4,6-tris(4-methylphenyl)-, FLJCTCVDRKPLHJ-UHFFFAOYSA-N, 2,4,6-tri(p-tolyl)-1,3,5-triazine, 2,4,6-tri(p-tolyl) -1,3,5-triazine, 2,4,6-Tris(4-methylphenyl)-1,3,5-triazine #