2,4,6-Triisopropylbenzoic Acid, 97%, 97%
cas: 49623-71-4 — see every product listed under this CAS number, including other names
2,4,6-Triisopropylbenzoic Acid, 97%, 97% (CAS 49623-71-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114FNC-250mg |
| cas | 49623-71-4 |
| size | 250mg |
| availability | 200g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 304.40 Pln | |
| Chemat | 10g | 477.20 Pln | |
| Chemat | 25g | 957.20 Pln | |
| Chemat | 50g | 1648.40 Pln | |
| Chemat | 100g | 2886.80 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2,4,6-tri(propan-2-yl)benzoic acid (CAS 49623-71-4) is a chemical compound with the molecular formula C16H24O2 and a molecular weight of 248.36 g/mol. IUPAC name: 2,4,6-tri(propan-2-yl)benzoic acid. InChIKey: ULVHAZFBJJXIDO-UHFFFAOYSA-N.
| Molecular formula | C16H24O2 |
|---|---|
| Molecular weight | 248.36 g/mol |
| IUPAC name | 2,4,6-tri(propan-2-yl)benzoic acid |
| InChIKey | ULVHAZFBJJXIDO-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=C(C(=C1)C(C)C)C(=O)O)C(C)C |
Computed by PubChem (NCBI)
Synonyms:
2,4,6-Triisopropylbenzoic acid, 2,4,6-Tris(1-methylethyl)benzoic acid, 2,4,6-tri(propan-2-yl)benzoic acid, 2,4,6-Triisopropyl benzoic acid, 2,4,6-tris(propan-2-yl)benzoic acid, Benzoic acid, 2,4,6-tris(1-methylethyl)-, 2,4,6-tris(methylethyl)benzoic acid, 2,4,6-Triisopropylbenzoic, 2,4,6-Triisopropylbenzoicacid, (2,4,6-triisopropyl)benzoic acid