2,4,6-Triisopropylbenzoic acid 97%
cas: 49623-71-4 — see every product listed under this CAS number, including other names
2,4,6-Triisopropylbenzoic acid 97% (CAS 49623-71-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A320999-250mg |
| cas | 49623-71-4 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 142.31 Pln | |
| Ambeed | 5g | 331.44 Pln | |
| Ambeed | 10g | 487.19 Pln | |
| Ambeed | 25g | 1093.50 Pln | |
| Ambeed | 100g | 3340.75 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A320999 |
2,4,6-tri(propan-2-yl)benzoic acid (CAS 49623-71-4) is a chemical compound with the molecular formula C16H24O2 and a molecular weight of 248.36 g/mol. IUPAC name: 2,4,6-tri(propan-2-yl)benzoic acid. InChIKey: ULVHAZFBJJXIDO-UHFFFAOYSA-N.
| Molecular formula | C16H24O2 |
|---|---|
| Molecular weight | 248.36 g/mol |
| IUPAC name | 2,4,6-tri(propan-2-yl)benzoic acid |
| InChIKey | ULVHAZFBJJXIDO-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=C(C(=C1)C(C)C)C(=O)O)C(C)C |
Computed by PubChem (NCBI)
Synonyms:
2,4,6-Triisopropylbenzoic acid, 2,4,6-Tris(1-methylethyl)benzoic acid, 2,4,6-tri(propan-2-yl)benzoic acid, 2,4,6-Triisopropyl benzoic acid, 2,4,6-tris(propan-2-yl)benzoic acid, Benzoic acid, 2,4,6-tris(1-methylethyl)-, 2,4,6-tris(methylethyl)benzoic acid, 2,4,6-Triisopropylbenzoic, 2,4,6-Triisopropylbenzoicacid, (2,4,6-triisopropyl)benzoic acid