cas: 195136-46-0 — see every product listed under this CAS number, including other names
2,4-Bis(trifluoromethyl)benzyl chloride (CAS 195136-46-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F006023-1G |
| cas | 195136-46-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 747.67 Pln | |
| Fluorochem | 5g | 1976.41 Pln |
| delivery time | 2-3 weeks |
|---|
1-(chloromethyl)-2,4-bis(trifluoromethyl)benzene (CAS 195136-46-0) is a chemical compound with the molecular formula C9H5ClF6 and a molecular weight of 262.58 g/mol. IUPAC name: 1-(chloromethyl)-2,4-bis(trifluoromethyl)benzene. InChIKey: DPKQSESRNWBUFZ-UHFFFAOYSA-N.
| Molecular formula | C9H5ClF6 |
|---|---|
| Molecular weight | 262.58 g/mol |
| IUPAC name | 1-(chloromethyl)-2,4-bis(trifluoromethyl)benzene |
| InChIKey | DPKQSESRNWBUFZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)C(F)(F)F)CCl |
Computed by PubChem (NCBI)