CAS 2256760-24-2 appears in our catalog under these names: 2,6-Dibromo-4-(tert-butyl)pyridine 98%, 2,6-Dibromo-4-(tert-butyl)pyridine, 98%, 98%, 2,6-Dibromo-4-(tert-butyl)pyridine, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 250mg, 1g, 5g, 100mg.
2,6-dibromo-4-tert-butylpyridine (CAS 2256760-24-2) is a chemical compound with the molecular formula C9H11Br2N and a molecular weight of 293.00 g/mol. IUPAC name: 2,6-dibromo-4-tert-butylpyridine. InChIKey: FZOURHZGJHNYQH-UHFFFAOYSA-N.
| Molecular formula | C9H11Br2N |
|---|---|
| Molecular weight | 293.00 g/mol |
| IUPAC name | 2,6-dibromo-4-tert-butylpyridine |
| InChIKey | FZOURHZGJHNYQH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=NC(=C1)Br)Br |
Computed by PubChem (NCBI)