CAS 68818-73-5 appears in our catalog under these names: 2,6-Dibromo-3,4,5-trimethylaniline 97%, 2,6-Dibromo-3,4,5-trimethylaniline, 97%, 97%, 2,6-Dibromo-3,4,5-trimethylaniline, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
2,6-dibromo-3,4,5-trimethylaniline (CAS 68818-73-5) is a chemical compound with the molecular formula C9H11Br2N and a molecular weight of 293.00 g/mol. IUPAC name: 2,6-dibromo-3,4,5-trimethylaniline. InChIKey: MWKUZGOLAYCHFG-UHFFFAOYSA-N.
| Molecular formula | C9H11Br2N |
|---|---|
| Molecular weight | 293.00 g/mol |
| IUPAC name | 2,6-dibromo-3,4,5-trimethylaniline |
| InChIKey | MWKUZGOLAYCHFG-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1C)Br)N)Br)C |
Computed by PubChem (NCBI)