cas: 1598-42-1 — see every product listed under this CAS number, including other names
2,4-Dichloro-5-(trifluoromethoxy)aniline 97% (CAS 1598-42-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A147834-100mg |
| cas | 1598-42-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 153.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A147834 |
2,4-dichloro-5-(trifluoromethoxy)aniline (CAS 1598-42-1) is a chemical compound with the molecular formula C7H4Cl2F3NO and a molecular weight of 246.01 g/mol. IUPAC name: 2,4-dichloro-5-(trifluoromethoxy)aniline. InChIKey: BGCXRQYQQFADKX-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2F3NO |
|---|---|
| Molecular weight | 246.01 g/mol |
| IUPAC name | 2,4-dichloro-5-(trifluoromethoxy)aniline |
| InChIKey | BGCXRQYQQFADKX-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1OC(F)(F)F)Cl)Cl)N |
Computed by PubChem (NCBI)