cas: 1598-42-1 — see every product listed under this CAS number, including other names
2,4-Dichloro-5-(trifluoromethoxy)aniline, 97%, 97% (CAS 1598-42-1) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112REJ-50mg |
| cas | 1598-42-1 |
| size | 50mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 88.40 Pln | |
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 309.20 Pln | |
| Chemat | 5g | 942.80 Pln | |
| Chemat | 10g | 1139.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2,4-dichloro-5-(trifluoromethoxy)aniline (CAS 1598-42-1) is a chemical compound with the molecular formula C7H4Cl2F3NO and a molecular weight of 246.01 g/mol. IUPAC name: 2,4-dichloro-5-(trifluoromethoxy)aniline. InChIKey: BGCXRQYQQFADKX-UHFFFAOYSA-N.
| Molecular formula | C7H4Cl2F3NO |
|---|---|
| Molecular weight | 246.01 g/mol |
| IUPAC name | 2,4-dichloro-5-(trifluoromethoxy)aniline |
| InChIKey | BGCXRQYQQFADKX-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1OC(F)(F)F)Cl)Cl)N |
Computed by PubChem (NCBI)