cas: 63558-77-0 — see every product listed under this CAS number, including other names
2,4-Dichloro-5-phenylpyrimidine 97% (CAS 63558-77-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A878622-100mg |
| cas | 63558-77-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 542.81 Pln | |
| Ambeed | 250mg | 882.12 Pln | |
| Ambeed | 1g | 2167.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A878622 |
2,4-dichloro-5-phenylpyrimidine (CAS 63558-77-0) is a chemical compound with the molecular formula C10H6Cl2N2 and a molecular weight of 225.07 g/mol. IUPAC name: 2,4-dichloro-5-phenylpyrimidine. InChIKey: JGQCQTSPGLAPOG-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2N2 |
|---|---|
| Molecular weight | 225.07 g/mol |
| IUPAC name | 2,4-dichloro-5-phenylpyrimidine |
| InChIKey | JGQCQTSPGLAPOG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)