cas: 63558-77-0 — see every product listed under this CAS number, including other names
2,4-Dichloro-5-phenylpyrimidine, 97%, 97% (CAS 63558-77-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114FQL-5g |
| cas | 63558-77-0 |
| size | 5g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 8901.20 Pln | |
| Chemat | 100mg | 554.00 Pln | |
| Chemat | 250mg | 899.60 Pln | |
| Chemat | 1g | 2272.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2,4-dichloro-5-phenylpyrimidine (CAS 63558-77-0) is a chemical compound with the molecular formula C10H6Cl2N2 and a molecular weight of 225.07 g/mol. IUPAC name: 2,4-dichloro-5-phenylpyrimidine. InChIKey: JGQCQTSPGLAPOG-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2N2 |
|---|---|
| Molecular weight | 225.07 g/mol |
| IUPAC name | 2,4-dichloro-5-phenylpyrimidine |
| InChIKey | JGQCQTSPGLAPOG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)