2,4-Dichloro-5-phenylpyrimidine, 97%
cas: 63558-77-0 — see every product listed under this CAS number, including other names
2,4-Dichloro-5-phenylpyrimidine, 97% (CAS 63558-77-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A878622-100mg |
| cas | 63558-77-0 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 498.31 Pln | |
| Ambeed | 250mg | 804.25 Pln | |
| Ambeed | 1g | 1972.38 Pln | |
| Chemat | 100mg | 650.00 Pln | |
| Chemat | 250mg | 1062.80 Pln | |
| Chemat | 1g | 2699.60 Pln | |
| Chemat | 5g | 10610.00 Pln | |
| BLDpharm | 100mg | 530.95 Pln | |
| BLDpharm | 250mg | 864.16 Pln | |
| BLDpharm | 1g | 2124.83 Pln | |
| Fluorochem | 1g | 5006.59 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
2,4-dichloro-5-phenylpyrimidine (CAS 63558-77-0) is a chemical compound with the molecular formula C10H6Cl2N2 and a molecular weight of 225.07 g/mol. IUPAC name: 2,4-dichloro-5-phenylpyrimidine. InChIKey: JGQCQTSPGLAPOG-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2N2 |
|---|---|
| Molecular weight | 225.07 g/mol |
| IUPAC name | 2,4-dichloro-5-phenylpyrimidine |
| InChIKey | JGQCQTSPGLAPOG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)