CAS 954220-58-7 is the registry number for 4-chloro-6-(2-chlorophenyl)pyrimidine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g, 50g.
4-chloro-6-(2-chlorophenyl)pyrimidine (CAS 954220-58-7) is a chemical compound with the molecular formula C10H6Cl2N2 and a molecular weight of 225.07 g/mol. IUPAC name: 4-chloro-6-(2-chlorophenyl)pyrimidine. InChIKey: MPGGOLBLCMAMNO-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2N2 |
|---|---|
| Molecular weight | 225.07 g/mol |
| IUPAC name | 4-chloro-6-(2-chlorophenyl)pyrimidine |
| InChIKey | MPGGOLBLCMAMNO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC(=NC=N2)Cl)Cl |
Computed by PubChem (NCBI)