2,4-Dichloro-7-(trifluoromethyl)quinazoline, 97%
cas: 396-02-1 — see every product listed under this CAS number, including other names
2,4-Dichloro-7-(trifluoromethyl)quinazoline, 97% (CAS 396-02-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch1148XK-100mg |
| cas | 396-02-1 |
| size | 100mg |
| availability | 20g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 170.00 Pln | |
| Chemat | 250mg | 174.80 Pln | |
| Chemat | 500mg | 285.20 Pln | |
| Chemat | 1g | 472.40 Pln | |
| Chemat | 5g | 1941.20 Pln | |
| Chemat | 10g | 3558.80 Pln | |
| Fluorochem | 100mg | 237.43 Pln | |
| Fluorochem | 250mg | 357.18 Pln | |
| Fluorochem | 1g | 700.81 Pln | |
| Fluorochem | 5g | 3022.91 Pln | |
| Fluorochem | 500mg | 518.59 Pln | |
| Fluorochem | 10g | 5324.18 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2,4-dichloro-7-(trifluoromethyl)quinazoline (CAS 396-02-1) is a chemical compound with the molecular formula C9H3Cl2F3N2 and a molecular weight of 267.03 g/mol. IUPAC name: 2,4-dichloro-7-(trifluoromethyl)quinazoline. InChIKey: PRJBXUBPUYNFQF-UHFFFAOYSA-N.
| Molecular formula | C9H3Cl2F3N2 |
|---|---|
| Molecular weight | 267.03 g/mol |
| IUPAC name | 2,4-dichloro-7-(trifluoromethyl)quinazoline |
| InChIKey | PRJBXUBPUYNFQF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)N=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)