2,4-Dichloro-N-pentylbenzamide, 97%
cas: 2447-88-3 — see every product listed under this CAS number, including other names
2,4-Dichloro-N-pentylbenzamide, 97% (CAS 2447-88-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A407736-250mg |
| cas | 2447-88-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 392.62 Pln | |
| Ambeed | 5g | 1227.00 Pln | |
| Chemat | 250mg | 141.20 Pln | |
| Chemat | 1g | 280.40 Pln | |
| Chemat | 5g | 698.00 Pln | |
| BLDpharm | 250mg | 214.39 Pln | |
| BLDpharm | 1g | 419.88 Pln | |
| BLDpharm | 5g | 1319.56 Pln | |
| Fluorochem | 250mg | 232.23 Pln | |
| Fluorochem | 1g | 497.76 Pln | |
| Fluorochem | 5g | 1289.15 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
2,4-dichloro-N-pentylbenzamide (CAS 2447-88-3) is a chemical compound with the molecular formula C12H15Cl2NO and a molecular weight of 260.16 g/mol. IUPAC name: 2,4-dichloro-N-pentylbenzamide. InChIKey: QLFOKAOJSCZXRM-UHFFFAOYSA-N.
| Molecular formula | C12H15Cl2NO |
|---|---|
| Molecular weight | 260.16 g/mol |
| IUPAC name | 2,4-dichloro-N-pentylbenzamide |
| InChIKey | QLFOKAOJSCZXRM-UHFFFAOYSA-N |
| SMILES | CCCCCNC(=O)C1=C(C=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)