cas: 19719-28-9 — see every product listed under this CAS number, including other names
2,4-Dichlorophenylacetic acid 98+% (CAS 19719-28-9) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1477052-25g |
| cas | 19719-28-9 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 120.06 Pln | |
| Ambeed | 100g | 248.00 Pln | |
| Ambeed | 500g | 298.06 Pln | |
| Ambeed | 1000g | 526.12 Pln |
| purity | 98+% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1477052 |
2-(2,4-dichlorophenyl)acetic acid (CAS 19719-28-9) is a chemical compound with the molecular formula C8H6Cl2O2 and a molecular weight of 205.03 g/mol. IUPAC name: 2-(2,4-dichlorophenyl)acetic acid. InChIKey: GXMWLJKTGBZMBH-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O2 |
|---|---|
| Molecular weight | 205.03 g/mol |
| IUPAC name | 2-(2,4-dichlorophenyl)acetic acid |
| InChIKey | GXMWLJKTGBZMBH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)CC(=O)O |
Computed by PubChem (NCBI)