cas: 19719-28-9 — see every product listed under this CAS number, including other names
2,4-Dichlorophenylacetic acid, 99%, 99% (CAS 19719-28-9) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 300g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113ANM-25g |
| cas | 19719-28-9 |
| size | 25g |
| availability | 2500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 78.80 Pln | |
| Chemat | 100g | 88.40 Pln | |
| Chemat | 300g | 160.40 Pln | |
| Chemat | 500g | 240.00 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
2-(2,4-dichlorophenyl)acetic acid (CAS 19719-28-9) is a chemical compound with the molecular formula C8H6Cl2O2 and a molecular weight of 205.03 g/mol. IUPAC name: 2-(2,4-dichlorophenyl)acetic acid. InChIKey: GXMWLJKTGBZMBH-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O2 |
|---|---|
| Molecular weight | 205.03 g/mol |
| IUPAC name | 2-(2,4-dichlorophenyl)acetic acid |
| InChIKey | GXMWLJKTGBZMBH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)CC(=O)O |
Computed by PubChem (NCBI)