cas: 446-35-5 — see every product listed under this CAS number, including other names
2,4-Difluoro-1-nitrobenzene 98% (CAS 446-35-5) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A321735-25g |
| cas | 446-35-5 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 197.94 Pln | |
| Ambeed | 100g | 220.19 Pln | |
| Ambeed | 500g | 414.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A321735 |
2,4-difluoro-1-nitrobenzene (CAS 446-35-5) is a chemical compound with the molecular formula C6H3F2NO2 and a molecular weight of 159.09 g/mol. IUPAC name: 2,4-difluoro-1-nitrobenzene. InChIKey: RJXOVESYJFXCGI-UHFFFAOYSA-N.
| Molecular formula | C6H3F2NO2 |
|---|---|
| Molecular weight | 159.09 g/mol |
| IUPAC name | 2,4-difluoro-1-nitrobenzene |
| InChIKey | RJXOVESYJFXCGI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)