cas: 446-35-5 — see every product listed under this CAS number, including other names
2,4-Difluoronitrobenzene, >99.0%(GC) (CAS 446-35-5) is a chemical reagent available from Chemat. Available pack sizes: 25g, 500g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D1636-25G |
| cas | 446-35-5 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 198.51 Pln | |
| TCI | 500g | 641.06 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >99.0%(GC) |
2,4-difluoro-1-nitrobenzene (CAS 446-35-5) is a chemical compound with the molecular formula C6H3F2NO2 and a molecular weight of 159.09 g/mol. IUPAC name: 2,4-difluoro-1-nitrobenzene. InChIKey: RJXOVESYJFXCGI-UHFFFAOYSA-N.
| Molecular formula | C6H3F2NO2 |
|---|---|
| Molecular weight | 159.09 g/mol |
| IUPAC name | 2,4-difluoro-1-nitrobenzene |
| InChIKey | RJXOVESYJFXCGI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)