2,4-Difluoro-3-isopropoxy-5-methylphenylboronic acid, 97%, 97%
cas: 2096339-90-9 — see every product listed under this CAS number, including other names
2,4-Difluoro-3-isopropoxy-5-methylphenylboronic acid, 97%, 97% (CAS 2096339-90-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12EHM9-100mg |
| cas | 2096339-90-9 |
| size | 100mg |
| availability | 3g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 381.20 Pln | |
| Chemat | 250mg | 606.80 Pln | |
| Chemat | 1g | 1370.00 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2,4-difluoro-5-methyl-3-propan-2-yloxyphenyl)boronic acid (CAS 2096339-90-9) is a chemical compound with the molecular formula C10H13BF2O3 and a molecular weight of 230.02 g/mol. IUPAC name: (2,4-difluoro-5-methyl-3-propan-2-yloxyphenyl)boronic acid. InChIKey: CJYRRWCWAJPESW-UHFFFAOYSA-N.
| Molecular formula | C10H13BF2O3 |
|---|---|
| Molecular weight | 230.02 g/mol |
| IUPAC name | (2,4-difluoro-5-methyl-3-propan-2-yloxyphenyl)boronic acid |
| InChIKey | CJYRRWCWAJPESW-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1F)OC(C)C)F)C)(O)O |
Computed by PubChem (NCBI)
Synonyms:
2,4-Difluoro-3-isopropoxy-5-methylphenylboronic acid, (2,4-Difluoro-3-isopropoxy-5-methylphenyl)boronic acid, Boronic acid, B-[2,4-difluoro-5-methyl-3-(1-methylethoxy)phenyl]-, (2,4-Difluoro-3-isopropoxy-5-methylphenyl)boronicacid, (2,4-difluoro-3-isopropoxy-5-methyl-phenyl)boronic acid, (2,4-difluoro-5-methyl-3-propan-2-yloxyphenyl)boronic acid, [2,4-difluoro-5-methyl-3-(propan-2-yloxy)phenyl]boronic acid, {2,4-Difluoro-5-methyl-3-[(propan-2-yl)oxy]phenyl}boronic acid