cas: 1780-83-2 — see every product listed under this CAS number, including other names
2,4-Difluoro-5-nitrobenzenesulfonyl chloride, 95+% (CAS 1780-83-2) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A709272-5g |
| cas | 1780-83-2 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 20296.57 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
2,4-difluoro-5-nitrobenzenesulfonyl chloride (CAS 1780-83-2) is a chemical compound with the molecular formula C6H2ClF2NO4S and a molecular weight of 257.60 g/mol. IUPAC name: 2,4-difluoro-5-nitrobenzenesulfonyl chloride. InChIKey: XAZYVFJSHFBTTM-UHFFFAOYSA-N.
| Molecular formula | C6H2ClF2NO4S |
|---|---|
| Molecular weight | 257.60 g/mol |
| IUPAC name | 2,4-difluoro-5-nitrobenzenesulfonyl chloride |
| InChIKey | XAZYVFJSHFBTTM-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1S(=O)(=O)Cl)F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)