CAS 1156136-97-8 appears in our catalog under these names: 2,3-Difluoro-5-nitrobenzene-1-sulfonyl chloride, 95%, 2,3-Difluoro-5-nitrobenzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2,3-difluoro-5-nitrobenzenesulfonyl chloride (CAS 1156136-97-8) is a chemical compound with the molecular formula C6H2ClF2NO4S and a molecular weight of 257.60 g/mol. IUPAC name: 2,3-difluoro-5-nitrobenzenesulfonyl chloride. InChIKey: WYXQNTSWZCZJDN-UHFFFAOYSA-N.
| Molecular formula | C6H2ClF2NO4S |
|---|---|
| Molecular weight | 257.60 g/mol |
| IUPAC name | 2,3-difluoro-5-nitrobenzenesulfonyl chloride |
| InChIKey | WYXQNTSWZCZJDN-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)F)S(=O)(=O)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)