Products 1156136-97-8

CAS 1156136-97-8 appears in our catalog under these names: 2,3-Difluoro-5-nitrobenzene-1-sulfonyl chloride, 95%, 2,3-Difluoro-5-nitrobenzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.

2,3-difluoro-5-nitrobenzenesulfonyl chloride (CAS 1156136-97-8) is a chemical compound with the molecular formula C6H2ClF2NO4S and a molecular weight of 257.60 g/mol. IUPAC name: 2,3-difluoro-5-nitrobenzenesulfonyl chloride. InChIKey: WYXQNTSWZCZJDN-UHFFFAOYSA-N.

Identity
Molecular formulaC6H2ClF2NO4S
Molecular weight257.60 g/mol
IUPAC name2,3-difluoro-5-nitrobenzenesulfonyl chloride
InChIKeyWYXQNTSWZCZJDN-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1F)F)S(=O)(=O)Cl)[N+](=O)[O-]

Computed by PubChem (NCBI)