Products 1394083-84-1

CAS 1394083-84-1 is the registry number for 4,5-Difluoro-2-nitrobenzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

4,5-difluoro-2-nitrobenzenesulfonyl chloride (CAS 1394083-84-1) is a chemical compound with the molecular formula C6H2ClF2NO4S and a molecular weight of 257.60 g/mol. IUPAC name: 4,5-difluoro-2-nitrobenzenesulfonyl chloride. InChIKey: JYVJVLADEKWZOM-UHFFFAOYSA-N.

Identity
Molecular formulaC6H2ClF2NO4S
Molecular weight257.60 g/mol
IUPAC name4,5-difluoro-2-nitrobenzenesulfonyl chloride
InChIKeyJYVJVLADEKWZOM-UHFFFAOYSA-N
SMILESC1=C(C(=CC(=C1F)F)S(=O)(=O)Cl)[N+](=O)[O-]

Computed by PubChem (NCBI)