CAS 1394083-84-1 is the registry number for 4,5-Difluoro-2-nitrobenzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4,5-difluoro-2-nitrobenzenesulfonyl chloride (CAS 1394083-84-1) is a chemical compound with the molecular formula C6H2ClF2NO4S and a molecular weight of 257.60 g/mol. IUPAC name: 4,5-difluoro-2-nitrobenzenesulfonyl chloride. InChIKey: JYVJVLADEKWZOM-UHFFFAOYSA-N.
| Molecular formula | C6H2ClF2NO4S |
|---|---|
| Molecular weight | 257.60 g/mol |
| IUPAC name | 4,5-difluoro-2-nitrobenzenesulfonyl chloride |
| InChIKey | JYVJVLADEKWZOM-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)S(=O)(=O)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)