Products 1193388-31-6
CAS 1193388-31-6 is the registry number for 2,6-Difluoro-4-nitrobenzene-1-sulfonyl chloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2,6-difluoro-4-nitrobenzenesulfonyl chloride (CAS 1193388-31-6) is a chemical compound with the molecular formula C6H2ClF2NO4S and a molecular weight of 257.60 g/mol. IUPAC name: 2,6-difluoro-4-nitrobenzenesulfonyl chloride. InChIKey: XMTMCDJHARJFGE-UHFFFAOYSA-N.
| Molecular formula | C6H2ClF2NO4S |
|---|---|
| Molecular weight | 257.60 g/mol |
| IUPAC name | 2,6-difluoro-4-nitrobenzenesulfonyl chloride |
| InChIKey | XMTMCDJHARJFGE-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)S(=O)(=O)Cl)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)