Products 1803826-81-4

CAS 1803826-81-4 is the registry number for 3,4-Difluoro-5-nitrobenzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3,4-difluoro-5-nitrobenzenesulfonyl chloride (CAS 1803826-81-4) is a chemical compound with the molecular formula C6H2ClF2NO4S and a molecular weight of 257.60 g/mol. IUPAC name: 3,4-difluoro-5-nitrobenzenesulfonyl chloride. InChIKey: ANKKCALWKAVFBE-UHFFFAOYSA-N.

Identity
Molecular formulaC6H2ClF2NO4S
Molecular weight257.60 g/mol
IUPAC name3,4-difluoro-5-nitrobenzenesulfonyl chloride
InChIKeyANKKCALWKAVFBE-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1[N+](=O)[O-])F)F)S(=O)(=O)Cl

Computed by PubChem (NCBI)