Products 89641-18-9

CAS 89641-18-9 appears in our catalog under these names: 2,4-Dimethoxypyrimidine-5-boronic acid, 98%, 2,4–Dimethoxyprimidine–5–boronic acid(contains varying amounts of Anhydride), 2,4-Dimethoxypyrimidine-5-boronic acid/ 95+%, 2,4-Dimethoxy-5-pyrimidylboronic Acid (contains varying amounts of Anhydride), >95.0%(T), 2,4-Dimethoxyprimidine-5-boronic acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, Chemat, TCI, MedChemExpress. Available pack sizes: 1g, 25g, 10g, 100g, 5g, 250mg, 5 g, 10 g.

Structural formula: {0} (CAS {1})

(2,4-dimethoxypyrimidin-5-yl)boronic acid (CAS 89641-18-9) is a chemical compound with the molecular formula C6H9BN2O4 and a molecular weight of 183.96 g/mol. IUPAC name: (2,4-dimethoxypyrimidin-5-yl)boronic acid. InChIKey: LKGKUACPLXCVOF-UHFFFAOYSA-N.

Identity
Molecular formulaC6H9BN2O4
Molecular weight183.96 g/mol
IUPAC name(2,4-dimethoxypyrimidin-5-yl)boronic acid
InChIKeyLKGKUACPLXCVOF-UHFFFAOYSA-N
SMILESB(C1=CN=C(N=C1OC)OC)(O)O

Computed by PubChem (NCBI)