cas: 259726-56-2 — see every product listed under this CAS number, including other names
2,4-Dimethyl-L-phenylalanine, 97%, 97% (CAS 259726-56-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113R9B-100mg |
| cas | 259726-56-2 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 299.60 Pln | |
| Chemat | 250mg | 477.20 Pln | |
| Chemat | 1g | 1302.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-amino-3-(2,4-dimethylphenyl)propanoic acid (CAS 259726-56-2) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: (2S)-2-amino-3-(2,4-dimethylphenyl)propanoic acid. InChIKey: ZEWXVRJSLTXWON-JTQLQIEISA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | (2S)-2-amino-3-(2,4-dimethylphenyl)propanoic acid |
| InChIKey | ZEWXVRJSLTXWON-JTQLQIEISA-N |
| SMILES | CC1=CC(=C(C=C1)C[C@@H](C(=O)O)N)C |
Computed by PubChem (NCBI)