CAS 259726-56-2 appears in our catalog under these names: L-2,4-Dimethylphenylalanine, 98%, H–Phe(2,4–DiMe)–OH, 2,4-Dimethyl-L-phenylalanine, 97%, 97%, (S)-2-Amino-3-(2,4-dimethylphenyl)propanoic acid, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 25g, 5g, 1g, 100mg, 500mg.
(2S)-2-amino-3-(2,4-dimethylphenyl)propanoic acid (CAS 259726-56-2) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: (2S)-2-amino-3-(2,4-dimethylphenyl)propanoic acid. InChIKey: ZEWXVRJSLTXWON-JTQLQIEISA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | (2S)-2-amino-3-(2,4-dimethylphenyl)propanoic acid |
| InChIKey | ZEWXVRJSLTXWON-JTQLQIEISA-N |
| SMILES | CC1=CC(=C(C=C1)C[C@@H](C(=O)O)N)C |
Computed by PubChem (NCBI)