CAS 465500-97-4 appears in our catalog under these names: D-2,4-Dimethylphenylalanine, 95%, H-D-Phe(2,4-DiMe)-OH, 98+%, D–2,4–Dimethylphenylalanine, D-2,4-Dimethylphenylalanine, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Fluorochem. Available pack sizes: 250mg, 5g, 1g.
(2R)-2-amino-3-(2,4-dimethylphenyl)propanoic acid (CAS 465500-97-4) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: (2R)-2-amino-3-(2,4-dimethylphenyl)propanoic acid. InChIKey: ZEWXVRJSLTXWON-SNVBAGLBSA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | (2R)-2-amino-3-(2,4-dimethylphenyl)propanoic acid |
| InChIKey | ZEWXVRJSLTXWON-SNVBAGLBSA-N |
| SMILES | CC1=CC(=C(C=C1)C[C@H](C(=O)O)N)C |
Computed by PubChem (NCBI)