cas: 41107-82-8 — see every product listed under this CAS number, including other names
2,5-Anhydro-D-mannitol 90% (CAS 41107-82-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A511963-100mg |
| cas | 41107-82-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 331.44 Pln | |
| Ambeed | 250mg | 498.31 Pln | |
| Ambeed | 1g | 1277.06 Pln | |
| Ambeed | 5g | 4887.12 Pln |
| purity | 90% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A511963 |
(2R,3S,4S,5R)-2,5-bis(hydroxymethyl)oxolane-3,4-diol (CAS 41107-82-8) is a chemical compound with the molecular formula C6H12O5 and a molecular weight of 164.16 g/mol. IUPAC name: (2R,3S,4S,5R)-2,5-bis(hydroxymethyl)oxolane-3,4-diol. InChIKey: MCHWWJLLPNDHGL-KVTDHHQDSA-N.
| Molecular formula | C6H12O5 |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | (2R,3S,4S,5R)-2,5-bis(hydroxymethyl)oxolane-3,4-diol |
| InChIKey | MCHWWJLLPNDHGL-KVTDHHQDSA-N |
| SMILES | C([C@@H]1[C@H]([C@@H]([C@H](O1)CO)O)O)O |
Computed by PubChem (NCBI)