CAS 41107-82-8 appears in our catalog under these names: 2,5-Anhydro-d-mannitol, 95%, 2,5-Anhydro-D-mannitol, >95% (HPLC), 2,5–Anhydro–D–mannitol, 2,5-Anhydro-D-mannitol, 2,5-Anhydro-D-mannitol, 98.00%. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Chemat. Available pack sizes: 250mg, 100mg, 50mg, 10mg, 25mg, 5mg, 1g, 500mg.
(2R,3S,4S,5R)-2,5-bis(hydroxymethyl)oxolane-3,4-diol (CAS 41107-82-8) is a chemical compound with the molecular formula C6H12O5 and a molecular weight of 164.16 g/mol. IUPAC name: (2R,3S,4S,5R)-2,5-bis(hydroxymethyl)oxolane-3,4-diol. InChIKey: MCHWWJLLPNDHGL-KVTDHHQDSA-N.
| Molecular formula | C6H12O5 |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | (2R,3S,4S,5R)-2,5-bis(hydroxymethyl)oxolane-3,4-diol |
| InChIKey | MCHWWJLLPNDHGL-KVTDHHQDSA-N |
| SMILES | C([C@@H]1[C@H]([C@@H]([C@H](O1)CO)O)O)O |
Computed by PubChem (NCBI)