cas: 41107-82-8 — see every product listed under this CAS number, including other names
2,5-Anhydro-D-mannitol, 98.00% (CAS 41107-82-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | CM02410C-100mg |
| cas | 41107-82-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 2255.07 Pln | |
| Chemat | 1g | 10924.08 Pln | |
| Chemat | 250mg | 4181.84 Pln | |
| Chemat | 500mg | 6716.42 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 98.00% |
| category | Chemicals |
(2R,3S,4S,5R)-2,5-bis(hydroxymethyl)oxolane-3,4-diol (CAS 41107-82-8) is a chemical compound with the molecular formula C6H12O5 and a molecular weight of 164.16 g/mol. IUPAC name: (2R,3S,4S,5R)-2,5-bis(hydroxymethyl)oxolane-3,4-diol. InChIKey: MCHWWJLLPNDHGL-KVTDHHQDSA-N.
| Molecular formula | C6H12O5 |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | (2R,3S,4S,5R)-2,5-bis(hydroxymethyl)oxolane-3,4-diol |
| InChIKey | MCHWWJLLPNDHGL-KVTDHHQDSA-N |
| SMILES | C([C@@H]1[C@H]([C@@H]([C@H](O1)CO)O)O)O |
Computed by PubChem (NCBI)