Products 28218-55-5
CAS 28218-55-5 appears in our catalog under these names: Isosorbide Impurity 7 (2,5-anhydro-D-iditol), 2,5-Anhydro-L-iditol. Offered by: Chemat Brand, Biosynth, Chemat. Available pack sizes: on request, 5mg, 2mg, 10mg, 25mg, 50mg.
(2S,3S,4S,5S)-2,5-bis(hydroxymethyl)oxolane-3,4-diol (CAS 28218-55-5) is a chemical compound with the molecular formula C6H12O5 and a molecular weight of 164.16 g/mol. IUPAC name: (2S,3S,4S,5S)-2,5-bis(hydroxymethyl)oxolane-3,4-diol. InChIKey: MCHWWJLLPNDHGL-UNTFVMJOSA-N.
| Molecular formula | C6H12O5 |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | (2S,3S,4S,5S)-2,5-bis(hydroxymethyl)oxolane-3,4-diol |
| InChIKey | MCHWWJLLPNDHGL-UNTFVMJOSA-N |
| SMILES | C([C@H]1[C@H]([C@@H]([C@@H](O1)CO)O)O)O |
Computed by PubChem (NCBI)