2,5-Dibutoxyterephthalaldehyde, 98%
cas: 564456-59-3 — see every product listed under this CAS number, including other names
2,5-Dibutoxyterephthalaldehyde, 98% (CAS 564456-59-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg, 5g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F569205-1G |
| cas | 564456-59-3 |
| size | 1g |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 976.76 Pln | |
| Ambeed | 100mg | 253.56 Pln | |
| Ambeed | 250mg | 414.88 Pln | |
| Ambeed | 1g | 948.88 Pln | |
| Ambeed | 5g | 3813.56 Pln | |
| Chemat | 100mg | 184.40 Pln | |
| Chemat | 250mg | 275.60 Pln | |
| Chemat | 1g | 674.00 Pln | |
| Chemat | 5g | 2426.00 Pln | |
| BLDpharm | 100mg | 269.93 Pln | |
| BLDpharm | 250mg | 442.09 Pln | |
| BLDpharm | 1g | 1019.67 Pln | |
| BLDpharm | 5g | 4101.91 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
2,5-dibutoxyterephthalaldehyde (CAS 564456-59-3) is a chemical compound with the molecular formula C16H22O4 and a molecular weight of 278.34 g/mol. IUPAC name: 2,5-dibutoxyterephthalaldehyde. InChIKey: YVTRGUBFSLFACU-UHFFFAOYSA-N.
| Molecular formula | C16H22O4 |
|---|---|
| Molecular weight | 278.34 g/mol |
| IUPAC name | 2,5-dibutoxyterephthalaldehyde |
| InChIKey | YVTRGUBFSLFACU-UHFFFAOYSA-N |
| SMILES | CCCCOC1=CC(=C(C=C1C=O)OCCCC)C=O |
Computed by PubChem (NCBI)