Products 885279-96-9

CAS 885279-96-9 is the registry number for 2-(3-Methoxy-benzyl)-3-oxo-hexanoic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 2-[(3-methoxyphenyl)methyl]-3-oxohexanoate (CAS 885279-96-9) is a chemical compound with the molecular formula C16H22O4 and a molecular weight of 278.34 g/mol. IUPAC name: ethyl 2-[(3-methoxyphenyl)methyl]-3-oxohexanoate. InChIKey: SRCCKFZPOLVTMF-UHFFFAOYSA-N.

Identity
Molecular formulaC16H22O4
Molecular weight278.34 g/mol
IUPAC nameethyl 2-[(3-methoxyphenyl)methyl]-3-oxohexanoate
InChIKeySRCCKFZPOLVTMF-UHFFFAOYSA-N
SMILESCCCC(=O)C(CC1=CC(=CC=C1)OC)C(=O)OCC

Computed by PubChem (NCBI)