CAS 819050-88-9 appears in our catalog under these names: Alpha,alpha,alpha',alpha'-tetramethyl-1,3-benzenedipropionic acid, 98%, α,α,α',α'–Tetramethyl–1,3–benzenedipropionic acid, ±,±,±²,±²-Tetramethyl-1,3-benzenedipropionic acid, alpha,alpha,alpha',alpha'-Tetramethyl-1,3-benzenedipropionic Acid, >98.0%(GC)(T), ALPHA,ALPHA,ALPHA',ALPHA'-TET&. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Sigma-Aldrich. Available pack sizes: 1g, 250mg, 100mg, 10g, 2,5g, 50mg, 500mg, 5g.
3-[3-(2-carboxy-2-methylpropyl)phenyl]-2,2-dimethylpropanoic acid (CAS 819050-88-9) is a chemical compound with the molecular formula C16H22O4 and a molecular weight of 278.34 g/mol. IUPAC name: 3-[3-(2-carboxy-2-methylpropyl)phenyl]-2,2-dimethylpropanoic acid. InChIKey: BZWQVGTVYGEXTE-UHFFFAOYSA-N.
| Molecular formula | C16H22O4 |
|---|---|
| Molecular weight | 278.34 g/mol |
| IUPAC name | 3-[3-(2-carboxy-2-methylpropyl)phenyl]-2,2-dimethylpropanoic acid |
| InChIKey | BZWQVGTVYGEXTE-UHFFFAOYSA-N |
| SMILES | CC(C)(CC1=CC(=CC=C1)CC(C)(C)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)