Products 28313-42-0
CAS 28313-42-0 is the registry number for Di-tert-butyl terephthalate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
Ditert-butyl benzene-1,4-dicarboxylate (CAS 28313-42-0) is a chemical compound with the molecular formula C16H22O4 and a molecular weight of 278.34 g/mol. IUPAC name: ditert-butyl benzene-1,4-dicarboxylate. InChIKey: JAIQCFIFVNAAAY-UHFFFAOYSA-N.
| Molecular formula | C16H22O4 |
|---|---|
| Molecular weight | 278.34 g/mol |
| IUPAC name | ditert-butyl benzene-1,4-dicarboxylate |
| InChIKey | JAIQCFIFVNAAAY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC=C(C=C1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)
Synonyms:
Di-t-butyl terephthalate, Di-tert-butyl terephthalate, ditert-butyl benzene-1,4-dicarboxylate, 1,4-Benzenedicarboxylic acid, bis(1,1-dimethylethyl) ester, terephthalic acid di-tert-butyl ester, di-t-butylterephthalate, Di-tert-butylterephthalate, JAIQCFIFVNAAAY-UHFFFAOYSA-N, 1,4-di(tert-butyl) terephthalate, Di-tert-butyl benzene-1,4-dicarboxylate