Products 3126-90-7
CAS 3126-90-7 appears in our catalog under these names: Dibutyl isophthalate, 95%, Dibutyl isophthalate, Dibutyl isophthalate, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 25g.
Dibutyl benzene-1,3-dicarboxylate (CAS 3126-90-7) is a chemical compound with the molecular formula C16H22O4 and a molecular weight of 278.34 g/mol. IUPAC name: dibutyl benzene-1,3-dicarboxylate. InChIKey: GOPWOUQJIMLDDM-UHFFFAOYSA-N.
| Molecular formula | C16H22O4 |
|---|---|
| Molecular weight | 278.34 g/mol |
| IUPAC name | dibutyl benzene-1,3-dicarboxylate |
| InChIKey | GOPWOUQJIMLDDM-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)C1=CC(=CC=C1)C(=O)OCCCC |
Computed by PubChem (NCBI)
Synonyms:
Dibutyl isophthalate, 1,3-Dibutyl 1,3-benzenedicarboxylate, dibutyl benzene-1,3-dicarboxylate, 1,3-Benzenedicarboxylic acid, dibutyl ester, ISOPHTHALIC ACID, DIBUTYL ESTER, 1,3-dibutyl benzene-1,3-dicarboxylate, 1,3-Benzenedicarboxylicacid, 1,3-dibutyl ester, dibutylisophthalate, Dibutyl isophthlate, Di-n-butylisophthlate