2,5-Dichlorobenzenesulfonamide, 97%
cas: 7720-45-8 — see every product listed under this CAS number, including other names
2,5-Dichlorobenzenesulfonamide, 97% (CAS 7720-45-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F034652-250MG |
| cas | 7720-45-8 |
| size | 250mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 357.18 Pln | |
| Fluorochem | 1g | 810.15 Pln | |
| Fluorochem | 5g | 2622.01 Pln | |
| Fluorochem | 10g | 4662.96 Pln | |
| Ambeed | 250mg | 214.62 Pln | |
| Ambeed | 1g | 359.25 Pln | |
| Ambeed | 5g | 1171.38 Pln | |
| Ambeed | 10g | 2200.44 Pln | |
| Ambeed | 25g | 4336.44 Pln | |
| Chemat | 250mg | 208.40 Pln | |
| Chemat | 1g | 443.60 Pln | |
| Chemat | 5g | 1418.00 Pln | |
| BLDpharm | 250mg | 225.50 Pln | |
| BLDpharm | 1g | 386.56 Pln | |
| BLDpharm | 5g | 1258.47 Pln | |
| BLDpharm | 10g | 2369.19 Pln | |
| BLDpharm | 25g | 4668.38 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
2,5-dichlorobenzenesulfonamide (CAS 7720-45-8) is a chemical compound with the molecular formula C6H5Cl2NO2S and a molecular weight of 226.08 g/mol. IUPAC name: 2,5-dichlorobenzenesulfonamide. InChIKey: UMHSKUILJUFIEK-UHFFFAOYSA-N.
| Molecular formula | C6H5Cl2NO2S |
|---|---|
| Molecular weight | 226.08 g/mol |
| IUPAC name | 2,5-dichlorobenzenesulfonamide |
| InChIKey | UMHSKUILJUFIEK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)S(=O)(=O)N)Cl |
Computed by PubChem (NCBI)