Products 473-29-0
CAS 473-29-0 appears in our catalog under these names: Dichloramine b, 95%, Dichloramine B, Dichloramine B, N,N-Dichlorobenzenesulfonamide, Dichloramine B, >95.0%(T). Offered by: Combi-blocks, TRC, GLPBio, Biosynth, TCI. Available pack sizes: 25g, 1g, 5g, 100mg, 500mg, 50mg, 100g, 500g.
N,N-dichlorobenzenesulfonamide (CAS 473-29-0) is a chemical compound with the molecular formula C6H5Cl2NO2S and a molecular weight of 226.08 g/mol. IUPAC name: N,N-dichlorobenzenesulfonamide. InChIKey: PJBJJXCZRAHMCK-UHFFFAOYSA-N.
| Molecular formula | C6H5Cl2NO2S |
|---|---|
| Molecular weight | 226.08 g/mol |
| IUPAC name | N,N-dichlorobenzenesulfonamide |
| InChIKey | PJBJJXCZRAHMCK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N(Cl)Cl |
Computed by PubChem (NCBI)