Products 1820647-64-0
CAS 1820647-64-0 appears in our catalog under these names: 2,6-Dichloro-3-methanesulfonylpyridine, 95%, 2,6-Dichloro-3-(methylsulfonyl)pyridine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g.
2,6-dichloro-3-methylsulfonylpyridine (CAS 1820647-64-0) is a chemical compound with the molecular formula C6H5Cl2NO2S and a molecular weight of 226.08 g/mol. IUPAC name: 2,6-dichloro-3-methylsulfonylpyridine. InChIKey: FCAWJTAASJAISL-UHFFFAOYSA-N.
| Molecular formula | C6H5Cl2NO2S |
|---|---|
| Molecular weight | 226.08 g/mol |
| IUPAC name | 2,6-dichloro-3-methylsulfonylpyridine |
| InChIKey | FCAWJTAASJAISL-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(N=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)