cas: 146781-23-9 — see every product listed under this CAS number, including other names
2,5-Difluoro-4-hydroxybenzoic acid, 97%, 97% (CAS 146781-23-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112EBU-100mg |
| cas | 146781-23-9 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 318.80 Pln | |
| Chemat | 250mg | 496.40 Pln | |
| Chemat | 1g | 1480.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2,5-difluoro-4-hydroxybenzoic acid (CAS 146781-23-9) is a chemical compound with the molecular formula C7H4F2O3 and a molecular weight of 174.10 g/mol. IUPAC name: 2,5-difluoro-4-hydroxybenzoic acid. InChIKey: LKJAHLFAORUKHO-UHFFFAOYSA-N.
| Molecular formula | C7H4F2O3 |
|---|---|
| Molecular weight | 174.10 g/mol |
| IUPAC name | 2,5-difluoro-4-hydroxybenzoic acid |
| InChIKey | LKJAHLFAORUKHO-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)O)F)C(=O)O |
Computed by PubChem (NCBI)