Products 175968-39-5
CAS 175968-39-5 appears in our catalog under these names: 2,3-Difluoro-4-hydroxybenzoic acid, 96%, 2,3-Difluoro-4-hydroxybenzoic acid, 97% , 2,3-Difluoro-4-hydroxybenzoic acid, 2,3-Difluoro-4-hydroxybenzoic acid 97%, 2,3-Difluoro-4-hydroxybenzoic acid, 97%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Biosynth, Ambeed, Fluorochem. Available pack sizes: 1g, 25g, 5g, 2g, 100mg, 250mg.
2,3-difluoro-4-hydroxybenzoic acid (CAS 175968-39-5) is a chemical compound with the molecular formula C7H4F2O3 and a molecular weight of 174.10 g/mol. IUPAC name: 2,3-difluoro-4-hydroxybenzoic acid. InChIKey: XIZIDHMVDRRFBT-UHFFFAOYSA-N.
| Molecular formula | C7H4F2O3 |
|---|---|
| Molecular weight | 174.10 g/mol |
| IUPAC name | 2,3-difluoro-4-hydroxybenzoic acid |
| InChIKey | XIZIDHMVDRRFBT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)O)F)F)O |
Computed by PubChem (NCBI)
Synonyms:
2,3-difluoro-4-hydroxybenzoic acid, Benzoic acid, 2,3-difluoro-4-hydroxy-, 2,3-difluoro-4-hydroxy-benzoic Acid, 2,3-Diifluoro-4-hydroxybenzoic acid, 2,3-difluoro-4-hydroxybenzo, 2,3-difluoro-4-hydroxybenzoicacid, 4-hydroxy-2,3-difluoro-benzoic acid, 2,3-difluoro-4-hydroxybenzoic acid, AldrichCPR