CAS 126120-86-3 appears in our catalog under these names: 2,2-Difluoro-1,3-benzodioxol-4-ol, 96%, 2,2-Difluoro-1,3-benzodioxol-4-ol, 2,2-Difluorobenzo[d][1,3]dioxol-4-ol 95%, 2,2-Difluoro-1,3-benzodioxol-4-ol, 95%, 95%, 2,2-DIFLUOROBENZO[D][1,3]DIOXOL-4-OL, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 0,5g, 100mg, 250mg.
2,2-difluoro-1,3-benzodioxol-4-ol (CAS 126120-86-3) is a chemical compound with the molecular formula C7H4F2O3 and a molecular weight of 174.10 g/mol. IUPAC name: 2,2-difluoro-1,3-benzodioxol-4-ol. InChIKey: RZLKNZQTCHZQNT-UHFFFAOYSA-N.
| Molecular formula | C7H4F2O3 |
|---|---|
| Molecular weight | 174.10 g/mol |
| IUPAC name | 2,2-difluoro-1,3-benzodioxol-4-ol |
| InChIKey | RZLKNZQTCHZQNT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)OC(O2)(F)F)O |
Computed by PubChem (NCBI)