CAS 749230-45-3 appears in our catalog under these names: 4,5-Difluoro-3-hydroxybenzoic acid, 3,4-difluoro-5-hydroxybenzoic acid, 95%, 3,4-Difluoro-5-hydroxybenzoic acid 97%, 3,4-Difluoro-5-hydroxybenzoic acid, 97%, 97%, 3,4-Difluoro-5-hydroxybenzoic acid, 97%. Offered by: Biosynth, Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 10g, 1g, 5g, 100mg, 250mg.
3,4-difluoro-5-hydroxybenzoic acid (CAS 749230-45-3) is a chemical compound with the molecular formula C7H4F2O3 and a molecular weight of 174.10 g/mol. IUPAC name: 3,4-difluoro-5-hydroxybenzoic acid. InChIKey: MJJFPTDSRAEDCC-UHFFFAOYSA-N.
| Molecular formula | C7H4F2O3 |
|---|---|
| Molecular weight | 174.10 g/mol |
| IUPAC name | 3,4-difluoro-5-hydroxybenzoic acid |
| InChIKey | MJJFPTDSRAEDCC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1O)F)F)C(=O)O |
Computed by PubChem (NCBI)