Products 749230-51-1

CAS 749230-51-1 appears in our catalog under these names: 2,3-Difluoro-5-hydroxybenzoic acid, 95%, 2,3-Difluoro-5-hydroxybenzoic acid, ≥95%, ≥95%, 2,3-DIFLUORO-5-HYDROXYBENZOIC ACID, ≥95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2,3-difluoro-5-hydroxybenzoic acid (CAS 749230-51-1) is a chemical compound with the molecular formula C7H4F2O3 and a molecular weight of 174.10 g/mol. IUPAC name: 2,3-difluoro-5-hydroxybenzoic acid. InChIKey: UHGVHUUHCKECKJ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4F2O3
Molecular weight174.10 g/mol
IUPAC name2,3-difluoro-5-hydroxybenzoic acid
InChIKeyUHGVHUUHCKECKJ-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1C(=O)O)F)F)O

Computed by PubChem (NCBI)