CAS 749230-51-1 appears in our catalog under these names: 2,3-Difluoro-5-hydroxybenzoic acid, 95%, 2,3-Difluoro-5-hydroxybenzoic acid, ≥95%, ≥95%, 2,3-DIFLUORO-5-HYDROXYBENZOIC ACID, ≥95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g.
2,3-difluoro-5-hydroxybenzoic acid (CAS 749230-51-1) is a chemical compound with the molecular formula C7H4F2O3 and a molecular weight of 174.10 g/mol. IUPAC name: 2,3-difluoro-5-hydroxybenzoic acid. InChIKey: UHGVHUUHCKECKJ-UHFFFAOYSA-N.
| Molecular formula | C7H4F2O3 |
|---|---|
| Molecular weight | 174.10 g/mol |
| IUPAC name | 2,3-difluoro-5-hydroxybenzoic acid |
| InChIKey | UHGVHUUHCKECKJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)F)F)O |
Computed by PubChem (NCBI)