cas: 1542-36-5 — see every product listed under this CAS number, including other names
2,5-Difluoro-4-nitroaniline 98% (CAS 1542-36-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A277632-250mg |
| cas | 1542-36-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 442.69 Pln | |
| Ambeed | 5g | 1054.56 Pln | |
| Ambeed | 10g | 1594.12 Pln | |
| Ambeed | 25g | 3134.94 Pln | |
| Ambeed | 100g | 7618.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A277632 |
2,5-difluoro-4-nitroaniline (CAS 1542-36-5) is a chemical compound with the molecular formula C6H4F2N2O2 and a molecular weight of 174.10 g/mol. IUPAC name: 2,5-difluoro-4-nitroaniline. InChIKey: IBGGCVMFSJQOID-UHFFFAOYSA-N.
| Molecular formula | C6H4F2N2O2 |
|---|---|
| Molecular weight | 174.10 g/mol |
| IUPAC name | 2,5-difluoro-4-nitroaniline |
| InChIKey | IBGGCVMFSJQOID-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)[N+](=O)[O-])F)N |
Computed by PubChem (NCBI)